C17H24N2O3 — CID 111447043
N-(4-hydroxy-2-methylpentyl)-2-(5-methoxyindol-1-yl)acetamide (PubChem CID 111447043) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylpentyl)-2-(5-methoxyindol-1-yl)acetamide.
| Compound Name | N-(4-hydroxy-2-methylpentyl)-2-(5-methoxyindol-1-yl)acetamide |
|---|---|
| PubChem CID | 111447043 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(4-hydroxy-2-methylpentyl)-2-(5-methoxyindol-1-yl)acetamide |
| SMILES | COc1ccc2c(ccn2CC(=O)NCC(C)CC(C)O)c1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(8-13(2)20)10-18-17(21)11-19-7-6-14-9-15(22-3)4-5-16(14)19/h4-7,9,12-13,20H,8,10-11H2,1-3H3,(H,18,21) |
| InChIKey | UQCOYZOUMWJWJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |