C25H40O3Si2 — CID 11144749
(2R,5Z,9R,13R)-9,13-bis(triethylsilyloxy)bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol (PubChem CID 11144749) has the molecular formula C25H40O3Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (2R,5Z,9R,13R)-9,13-bis(triethylsilyloxy)bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol.
| Compound Name | (2R,5Z,9R,13R)-9,13-bis(triethylsilyloxy)bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
|---|---|
| PubChem CID | 11144749 |
| Molecular Formula | C25H40O3Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2R,5Z,9R,13R)-9,13-bis(triethylsilyloxy)bicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyn-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C2=CCC[C@@]1(O[Si](CC)(CC)CC)C#C/C=C\C#C[C@H]2O |
| InChI | InChI=1S/C25H40O3Si2/c1-7-29(8-2,9-3)27-24-22-18-17-21-25(24,28-30(10-4,11-5)12-6)20-16-14-13-15-19-23(22)26/h13-14,18,23-24,26H,7-12,17,21H2,1-6H3/b14-13-/t23-,24-,25+/m1/s1 |
| InChIKey | ABKGMKVSUBVVRU-ISIBUZAZSA-N |
| XLogP | 5.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|