C13H23N3O2 — CID 111447589
2-ethyl-N-(4-hydroxy-2-methylpentyl)-5-methylpyrazole-3-carboxamide (PubChem CID 111447589) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-ethyl-N-(4-hydroxy-2-methylpentyl)-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-(4-hydroxy-2-methylpentyl)-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 111447589 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-ethyl-N-(4-hydroxy-2-methylpentyl)-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)NCC(C)CC(C)O |
| InChI | InChI=1S/C13H23N3O2/c1-5-16-12(7-10(3)15-16)13(18)14-8-9(2)6-11(4)17/h7,9,11,17H,5-6,8H2,1-4H3,(H,14,18) |
| InChIKey | ZZATVOWFBFIRES-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |