C20H30N2O3 — CID 111448473
1-[3-[benzyl(methyl)amino]-2-hydroxypropyl]-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione (PubChem CID 111448473) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]-2-hydroxypropyl]-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[benzyl(methyl)amino]-2-hydroxypropyl]-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 111448473 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]-2-hydroxypropyl]-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)CC1(C)CC(=O)N(CC(O)CN(C)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H30N2O3/c1-15(2)10-20(3)11-18(24)22(19(20)25)14-17(23)13-21(4)12-16-8-6-5-7-9-16/h5-9,15,17,23H,10-14H2,1-4H3 |
| InChIKey | SMOCTZOCMNYLRH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|