C12H17BrFNO — CID 111449155
3-[(5-bromo-2-fluorophenyl)methylamino]pentan-1-ol (PubChem CID 111449155) has the molecular formula C12H17BrFNO and a molecular weight of 290.18 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)methylamino]pentan-1-ol.
| Compound Name | 3-[(5-bromo-2-fluorophenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 111449155 |
| Molecular Formula | C12H17BrFNO |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)methylamino]pentan-1-ol |
| SMILES | CCC(CCO)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C12H17BrFNO/c1-2-11(5-6-16)15-8-9-7-10(13)3-4-12(9)14/h3-4,7,11,15-16H,2,5-6,8H2,1H3 |
| InChIKey | ZRWBMJJIHOAMSU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |