C15H14F2N2O4 — CID 111449316
2-[[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]methyl]-4-nitrophenol (PubChem CID 111449316) has the molecular formula C15H14F2N2O4 and a molecular weight of 324.28 g/mol. Its IUPAC name is 2-[[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]methyl]-4-nitrophenol.
| Compound Name | 2-[[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 111449316 |
| Molecular Formula | C15H14F2N2O4 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 2-[[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]methyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(CNCC(O)c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C15H14F2N2O4/c16-11-2-1-3-12(17)15(11)14(21)8-18-7-9-6-10(19(22)23)4-5-13(9)20/h1-6,14,18,20-21H,7-8H2 |
| InChIKey | SCSOBAIFZJKJKD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|