C22H24N2O9 — CID 11144980
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate (PubChem CID 11144980) has the molecular formula C22H24N2O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11144980 |
| Molecular Formula | C22H24N2O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2ccc(=O)n(Cc3ccccc3)c2=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H24N2O9/c1-13(25)30-12-17-19(31-14(2)26)20(32-15(3)27)21(33-17)23-10-9-18(28)24(22(23)29)11-16-7-5-4-6-8-16/h4-10,17,19-21H,11-12H2,1-3H3/t17-,19-,20-,21-/m1/s1 |
| InChIKey | ZDFAJULOMOQIAS-CWJKEVGVSA-N |
| XLogP | 0.38 |
| TPSA | 132.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|