C26H42O5Si — CID 11145020
(1R,3R,7S,8S,10R,11S)-7-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-8,12,15,15-tetramethyl-2-oxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylic acid (PubChem CID 11145020) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is (1R,3R,7S,8S,10R,11S)-7-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-8,12,15,15-tetramethyl-2-oxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylic acid.
| Compound Name | (1R,3R,7S,8S,10R,11S)-7-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-8,12,15,15-tetramethyl-2-oxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 11145020 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (1R,3R,7S,8S,10R,11S)-7-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-8,12,15,15-tetramethyl-2-oxotricyclo[9.3.1.03,8]pentadeca-4,12-diene-4-carboxylic acid |
| SMILES | CC1=CC[C@H]2C(=O)[C@H]3C(C(=O)O)=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]3(C)C[C@@H](O)[C@@H]1C2(C)C |
| InChI | InChI=1S/C26H42O5Si/c1-15-10-12-17-22(28)21-16(23(29)30)11-13-19(31-32(8,9)24(2,3)4)26(21,7)14-18(27)20(15)25(17,5)6/h10-11,17-21,27H,12-14H2,1-9H3,(H,29,30)/t17-,18+,19-,20+,21+,26+/m0/s1 |
| InChIKey | RLAIVVYYIGIXRI-NSTSXWEISA-N |
| XLogP | 5.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|