C17H23NO3 — CID 111450791
N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]cyclopent-3-ene-1-carboxamide (PubChem CID 111450791) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]cyclopent-3-ene-1-carboxamide.
| Compound Name | N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]cyclopent-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 111450791 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[2-hydroxy-2-(4-propan-2-yloxyphenyl)ethyl]cyclopent-3-ene-1-carboxamide |
| SMILES | CC(C)Oc1ccc(C(O)CNC(=O)C2CC=CC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-12(2)21-15-9-7-13(8-10-15)16(19)11-18-17(20)14-5-3-4-6-14/h3-4,7-10,12,14,16,19H,5-6,11H2,1-2H3,(H,18,20) |
| InChIKey | ABQVFWCYCCVGBK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|