C19H21F2NO2 — CID 111451449
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-phenylpentanamide (PubChem CID 111451449) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-phenylpentanamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-phenylpentanamide |
|---|---|
| PubChem CID | 111451449 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-phenylpentanamide |
| SMILES | CCC(CC(=O)NCC(O)c1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C19H21F2NO2/c1-2-13(14-7-4-3-5-8-14)11-18(24)22-12-17(23)19-15(20)9-6-10-16(19)21/h3-10,13,17,23H,2,11-12H2,1H3,(H,22,24) |
| InChIKey | KJSDLRNDTJYGDZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |