C16H16ClN3O4 — CID 111452733
1-(4-chloro-3-nitrophenyl)-3-[(1R)-3-hydroxy-1-phenylpropyl]urea (PubChem CID 111452733) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-3-[(1R)-3-hydroxy-1-phenylpropyl]urea.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-3-[(1R)-3-hydroxy-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 111452733 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-[(1R)-3-hydroxy-1-phenylpropyl]urea |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)N[C@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O4/c17-13-7-6-12(10-15(13)20(23)24)18-16(22)19-14(8-9-21)11-4-2-1-3-5-11/h1-7,10,14,21H,8-9H2,(H2,18,19,22)/t14-/m1/s1 |
| InChIKey | VBUXVFHOWBHNRQ-CQSZACIVSA-N |
| XLogP | 3.49 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|