C15H23ClN2O3 — CID 111452995
1-(3-chloro-4-propan-2-yloxyphenyl)-3-(1-hydroxypentan-3-yl)urea (PubChem CID 111452995) has the molecular formula C15H23ClN2O3 and a molecular weight of 314.81 g/mol. Its IUPAC name is 1-(3-chloro-4-propan-2-yloxyphenyl)-3-(1-hydroxypentan-3-yl)urea.
| Compound Name | 1-(3-chloro-4-propan-2-yloxyphenyl)-3-(1-hydroxypentan-3-yl)urea |
|---|---|
| PubChem CID | 111452995 |
| Molecular Formula | C15H23ClN2O3 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(3-chloro-4-propan-2-yloxyphenyl)-3-(1-hydroxypentan-3-yl)urea |
| SMILES | CCC(CCO)NC(=O)Nc1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O3/c1-4-11(7-8-19)17-15(20)18-12-5-6-14(13(16)9-12)21-10(2)3/h5-6,9-11,19H,4,7-8H2,1-3H3,(H2,17,18,20) |
| InChIKey | ZHZXBTUCPYMPSP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |