C19H28N4O2 — CID 111453466
1-(2-hydroxy-2,5-dimethylhexyl)-3-[3-(1-methylimidazol-2-yl)phenyl]urea (PubChem CID 111453466) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(2-hydroxy-2,5-dimethylhexyl)-3-[3-(1-methylimidazol-2-yl)phenyl]urea.
| Compound Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-[3-(1-methylimidazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 111453466 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-[3-(1-methylimidazol-2-yl)phenyl]urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)Nc1cccc(-c2nccn2C)c1 |
| InChI | InChI=1S/C19H28N4O2/c1-14(2)8-9-19(3,25)13-21-18(24)22-16-7-5-6-15(12-16)17-20-10-11-23(17)4/h5-7,10-12,14,25H,8-9,13H2,1-4H3,(H2,21,22,24) |
| InChIKey | GQNYAAMGARCTMI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |