C19H22N2O3 — CID 111453499
1-(3-benzoylphenyl)-3-(1-hydroxypentan-3-yl)urea (PubChem CID 111453499) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(3-benzoylphenyl)-3-(1-hydroxypentan-3-yl)urea.
| Compound Name | 1-(3-benzoylphenyl)-3-(1-hydroxypentan-3-yl)urea |
|---|---|
| PubChem CID | 111453499 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-(3-benzoylphenyl)-3-(1-hydroxypentan-3-yl)urea |
| SMILES | CCC(CCO)NC(=O)Nc1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-16(11-12-22)20-19(24)21-17-10-6-9-15(13-17)18(23)14-7-4-3-5-8-14/h3-10,13,16,22H,2,11-12H2,1H3,(H2,20,21,24) |
| InChIKey | NFCANLYFYVSLFP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |