C29H50O4Si — CID 11145410
(1R,2Z,4S,5R,9R,11S,12S)-8,12-dimethyl-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-1,11-diol (PubChem CID 11145410) has the molecular formula C29H50O4Si and a molecular weight of 490.80 g/mol. Its IUPAC name is (1R,2Z,4S,5R,9R,11S,12S)-8,12-dimethyl-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-1,11-diol.
| Compound Name | (1R,2Z,4S,5R,9R,11S,12S)-8,12-dimethyl-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-1,11-diol |
|---|---|
| PubChem CID | 11145410 |
| Molecular Formula | C29H50O4Si |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.35 |
| IUPAC Name | (1R,2Z,4S,5R,9R,11S,12S)-8,12-dimethyl-5-propan-2-yl-2-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-1,11-diol |
| SMILES | CC1=CC[C@H](C(C)C)[C@H]2/C=C(/CO[Si](C(C)C)(C(C)C)C(C)C)[C@@]3(O)C=C[C@](C)(O3)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C29H50O4Si/c1-18(2)24-12-11-22(9)25-16-27(30)28(10)13-14-29(31,33-28)23(15-26(24)25)17-32-34(19(3)4,20(5)6)21(7)8/h11,13-15,18-21,24-27,30-31H,12,16-17H2,1-10H3/b23-15-/t24-,25+,26-,27+,28+,29-/m1/s1 |
| InChIKey | UTUPPAFZWYFAPO-OJRRLGOKSA-N |
| XLogP | 6.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|