C29H39NO6 — CID 11145497
(1S,2R)-N,N-dibenzyl-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine (PubChem CID 11145497) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is (1S,2R)-N,N-dibenzyl-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine.
| Compound Name | (1S,2R)-N,N-dibenzyl-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine |
|---|---|
| PubChem CID | 11145497 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | (1S,2R)-N,N-dibenzyl-2-methoxy-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propan-1-amine |
| SMILES | CO[C@H](C)[C@@H]([C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H39NO6/c1-19(31-6)22(30(17-20-13-9-7-10-14-20)18-21-15-11-8-12-16-21)23-24-25(34-28(2,3)33-24)26-27(32-23)36-29(4,5)35-26/h7-16,19,22-27H,17-18H2,1-6H3/t19-,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | YLGPMWQOTREIBI-IPFNAZMPSA-N |
| XLogP | 4.49 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |