C17H20F3N4O3S+ — CID 11145568
2-[methylsulfonyl-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]cyclohex-2-en-1-yl]amino]benzenediazonium (PubChem CID 11145568) has the molecular formula C17H20F3N4O3S+ and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-[methylsulfonyl-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]cyclohex-2-en-1-yl]amino]benzenediazonium.
| Compound Name | 2-[methylsulfonyl-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]cyclohex-2-en-1-yl]amino]benzenediazonium |
|---|---|
| PubChem CID | 11145568 |
| Molecular Formula | C17H20F3N4O3S+ |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[methylsulfonyl-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]cyclohex-2-en-1-yl]amino]benzenediazonium |
| SMILES | CS(=O)(=O)N(c1ccccc1[N+]#N)C1CCCC=C1CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N4O3S/c1-28(26,27)24(15-9-5-3-7-13(15)23-21)14-8-4-2-6-12(14)10-11-22-16(25)17(18,19)20/h3,5-7,9,14H,2,4,8,10-11H2,1H3/p+1 |
| InChIKey | YYQFVLBNYUKAAF-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|