C17H21FN2OS — CID 111457010
4-[cyclopropyl-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]amino]butan-1-ol (PubChem CID 111457010) has the molecular formula C17H21FN2OS and a molecular weight of 320.43 g/mol. Its IUPAC name is 4-[cyclopropyl-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]amino]butan-1-ol.
| Compound Name | 4-[cyclopropyl-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 111457010 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-[cyclopropyl-[[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl]amino]butan-1-ol |
| SMILES | OCCCCN(Cc1csc(-c2ccc(F)cc2)n1)C1CC1 |
| InChI | InChI=1S/C17H21FN2OS/c18-14-5-3-13(4-6-14)17-19-15(12-22-17)11-20(16-7-8-16)9-1-2-10-21/h3-6,12,16,21H,1-2,7-11H2 |
| InChIKey | DMJCLGDYSVDLTG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|