About 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol
7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol (PubChem CID 111457291) has the molecular formula C18H31N3O3
and a molecular weight of 337.46 g/mol. Its IUPAC name is 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol.
Molecular Properties
| Compound Name | 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol |
| PubChem CID | 111457291 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol |
| SMILES | CCCCc1noc(C(C)N2CCC3(CC2)C(O)CC3OCC)n1 |
| InChI | InChI=1S/C18H31N3O3/c1-4-6-7-16-19-17(24-20-16)13(3)21-10-8-18(9-11-21)14(22)12-15(18)23-5-2/h13-15,22H,4-12H2,1-3H3 |
| InChIKey | ZZCBRDIVINNXJP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The IUPAC name of 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol (CID 111457291) is 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol.
What is the SMILES notation for 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The canonical SMILES for 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol is CCCCc1noc(C(C)N2CCC3(CC2)C(O)CC3OCC)n1.
What is the InChIKey of 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The InChIKey is ZZCBRDIVINNXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N3O3/c1-4-6-7-16-19-17(24-20-16)13(3)21-10-8-18(9-11-21)14(22)12-15(18)23-5-2/h13-15,22H,4-12H2,1-3H3.
What are the key properties of 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol has a molecular weight of 337.46 g/mol, XLogP of 2.73, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol is sourced from PubChem (CID 111457291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).