C13H17BrN2O3 — CID 111457462
3-[(4-bromo-3-nitrophenyl)methylamino]-3-cyclopropylpropan-1-ol (PubChem CID 111457462) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is 3-[(4-bromo-3-nitrophenyl)methylamino]-3-cyclopropylpropan-1-ol.
| Compound Name | 3-[(4-bromo-3-nitrophenyl)methylamino]-3-cyclopropylpropan-1-ol |
|---|---|
| PubChem CID | 111457462 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3-[(4-bromo-3-nitrophenyl)methylamino]-3-cyclopropylpropan-1-ol |
| SMILES | O=[N+]([O-])c1cc(CNC(CCO)C2CC2)ccc1Br |
| InChI | InChI=1S/C13H17BrN2O3/c14-11-4-1-9(7-13(11)16(18)19)8-15-12(5-6-17)10-2-3-10/h1,4,7,10,12,15,17H,2-3,5-6,8H2 |
| InChIKey | ISRAAMMDSIDKPQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|