C16H29N5O2 — CID 111459092
1-[(1-ethylpiperidin-3-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 111459092) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(1-ethylpiperidin-3-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-[(1-ethylpiperidin-3-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 111459092 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 1-[(1-ethylpiperidin-3-yl)methyl]-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | CCN1CCCC(CNC(=O)NCC(C)(O)c2cnn(C)c2)C1 |
| InChI | InChI=1S/C16H29N5O2/c1-4-21-7-5-6-13(10-21)8-17-15(22)18-12-16(2,23)14-9-19-20(3)11-14/h9,11,13,23H,4-8,10,12H2,1-3H3,(H2,17,18,22) |
| InChIKey | ZJVIVLWIRFGRRA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |