C17H23ClN2O3 — CID 111459517
N-[4-chloro-3-(3-hydroxypiperidine-1-carbonyl)phenyl]-3-methylbutanamide (PubChem CID 111459517) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-[4-chloro-3-(3-hydroxypiperidine-1-carbonyl)phenyl]-3-methylbutanamide.
| Compound Name | N-[4-chloro-3-(3-hydroxypiperidine-1-carbonyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 111459517 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[4-chloro-3-(3-hydroxypiperidine-1-carbonyl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(Cl)c(C(=O)N2CCCC(O)C2)c1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(2)8-16(22)19-12-5-6-15(18)14(9-12)17(23)20-7-3-4-13(21)10-20/h5-6,9,11,13,21H,3-4,7-8,10H2,1-2H3,(H,19,22) |
| InChIKey | JYJBTDFIWAJTIP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |