C27H42N4O6S — CID 11146052
(3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid (PubChem CID 11146052) has the molecular formula C27H42N4O6S and a molecular weight of 550.72 g/mol. Its IUPAC name is (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid.
| Compound Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
|---|---|
| PubChem CID | 11146052 |
| Molecular Formula | C27H42N4O6S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | (3S,6R,7S,8S)-11-[(2R,3S)-3-[(E,2S)-2-azido-3-methyl-4-(2-methyl-1,3-thiazol-4-yl)but-3-enyl]-2-methyloxiran-2-yl]-3,7-dihydroxy-4,4,6,8-tetramethyl-5-oxoundecanoic acid |
| SMILES | C/C(=C\c1csc(C)n1)[C@H](C[C@@H]1O[C@]1(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O)N=[N+]=[N-] |
| InChI | InChI=1S/C27H42N4O6S/c1-15(24(35)17(3)25(36)26(5,6)21(32)13-23(33)34)9-8-10-27(7)22(37-27)12-20(30-31-28)16(2)11-19-14-38-18(4)29-19/h11,14-15,17,20-22,24,32,35H,8-10,12-13H2,1-7H3,(H,33,34)/b16-11+/t15-,17+,20-,21-,22-,24-,27+/m0/s1 |
| InChIKey | HSPDUMHVVMJWKK-PVYNADRNSA-N |
| XLogP | 5.32 |
| TPSA | 169.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|