C35H37NO5 — CID 11146057
1-[4,4-bis[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]piperidin-1-yl]ethanone (PubChem CID 11146057) has the molecular formula C35H37NO5 and a molecular weight of 551.68 g/mol. Its IUPAC name is 1-[4,4-bis[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4,4-bis[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 11146057 |
| Molecular Formula | C35H37NO5 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 1-[4,4-bis[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2ccc(OCc3ccc(CO)cc3)cc2)(c2ccc(OCc3ccc(CO)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H37NO5/c1-26(39)36-20-18-35(19-21-36,31-10-14-33(15-11-31)40-24-29-6-2-27(22-37)3-7-29)32-12-16-34(17-13-32)41-25-30-8-4-28(23-38)5-9-30/h2-17,37-38H,18-25H2,1H3 |
| InChIKey | NOAFPAPADNJVLF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |