C34H37NO6 — CID 11146089
(2R,3S,4R,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide (PubChem CID 11146089) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide.
| Compound Name | (2R,3S,4R,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
|---|---|
| PubChem CID | 11146089 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (2R,3S,4R,5R)-5-hydroxy-2,3,4,6-tetrakis(phenylmethoxy)hexanamide |
| SMILES | NC(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C34H37NO6/c35-34(37)33(41-24-29-19-11-4-12-20-29)32(40-23-28-17-9-3-10-18-28)31(39-22-27-15-7-2-8-16-27)30(36)25-38-21-26-13-5-1-6-14-26/h1-20,30-33,36H,21-25H2,(H2,35,37)/t30-,31-,32+,33-/m1/s1 |
| InChIKey | QSTAZHHZHIPWRR-NXVJRICRSA-N |
| XLogP | 4.81 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |