C15H20N2O3 — CID 111461213
2-(1,2-benzoxazol-3-yl)-N-(3-hydroxy-4-methylpentyl)acetamide (PubChem CID 111461213) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(3-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(3-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 111461213 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(3-hydroxy-4-methylpentyl)acetamide |
| SMILES | CC(C)C(O)CCNC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C15H20N2O3/c1-10(2)13(18)7-8-16-15(19)9-12-11-5-3-4-6-14(11)20-17-12/h3-6,10,13,18H,7-9H2,1-2H3,(H,16,19) |
| InChIKey | OIYWYZRNKBGCRE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |