C16H22F2N2O2S — CID 111462087
N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]acetamide (PubChem CID 111462087) has the molecular formula C16H22F2N2O2S and a molecular weight of 344.43 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 111462087 |
| Molecular Formula | C16H22F2N2O2S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[2-(3-hydroxypropyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCCC1CCCO)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H22F2N2O2S/c17-16(18)23-14-7-5-12(6-8-14)19-15(22)11-20-9-1-3-13(20)4-2-10-21/h5-8,13,16,21H,1-4,9-11H2,(H,19,22) |
| InChIKey | XWILZZBVJJARCJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |