C17H25FN2O3 — CID 111463405
N-(2-ethyl-2-hydroxybutyl)-3-fluoro-4-morpholin-4-ylbenzamide (PubChem CID 111463405) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-3-fluoro-4-morpholin-4-ylbenzamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-3-fluoro-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 111463405 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-3-fluoro-4-morpholin-4-ylbenzamide |
| SMILES | CCC(O)(CC)CNC(=O)c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C17H25FN2O3/c1-3-17(22,4-2)12-19-16(21)13-5-6-15(14(18)11-13)20-7-9-23-10-8-20/h5-6,11,22H,3-4,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | UTGBWKQLXSUMLY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |