About 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol
3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol (PubChem CID 111463888) has the molecular formula C14H20N4OS
and a molecular weight of 292.41 g/mol. Its IUPAC name is 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol |
| PubChem CID | 111463888 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol |
| SMILES | Cc1cccc(C)c1-n1nnnc1CSCC(C)CO |
| InChI | InChI=1S/C14H20N4OS/c1-10(7-19)8-20-9-13-15-16-17-18(13)14-11(2)5-4-6-12(14)3/h4-6,10,19H,7-9H2,1-3H3 |
| InChIKey | WZYCSUZCCZFHJM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol?
The IUPAC name of 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol (CID 111463888) is 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol.
What is the SMILES notation for 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol?
The canonical SMILES for 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol is Cc1cccc(C)c1-n1nnnc1CSCC(C)CO.
What is the InChIKey of 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol?
The InChIKey is WZYCSUZCCZFHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4OS/c1-10(7-19)8-20-9-13-15-16-17-18(13)14-11(2)5-4-6-12(14)3/h4-6,10,19H,7-9H2,1-3H3.
What are the key properties of 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol?
3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol has a molecular weight of 292.41 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,6-dimethylphenyl)tetrazol-5-yl]methylsulfanyl]-2-methylpropan-1-ol is sourced from PubChem (CID 111463888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).