C29H42INO4 — CID 11146391
(2R)-2-[(2S)-1-[(2E,4R,6E)-2-iodo-4-methyl-7-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-2,6-dienyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal (PubChem CID 11146391) has the molecular formula C29H42INO4 and a molecular weight of 595.56 g/mol. Its IUPAC name is (2R)-2-[(2S)-1-[(2E,4R,6E)-2-iodo-4-methyl-7-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-2,6-dienyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal.
| Compound Name | (2R)-2-[(2S)-1-[(2E,4R,6E)-2-iodo-4-methyl-7-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-2,6-dienyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal |
|---|---|
| PubChem CID | 11146391 |
| Molecular Formula | C29H42INO4 |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (2R)-2-[(2S)-1-[(2E,4R,6E)-2-iodo-4-methyl-7-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]octa-2,6-dienyl]pyrrolidin-2-yl]-2-phenylmethoxypropanal |
| SMILES | C/C(=C\C[C@@H](C)/C=C(/I)CN1CCC[C@H]1[C@](C)(C=O)OCc1ccccc1)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C29H42INO4/c1-21(14-15-22(2)27-23(3)34-28(4,5)35-27)17-25(30)18-31-16-10-13-26(31)29(6,20-32)33-19-24-11-8-7-9-12-24/h7-9,11-12,15,17,20-21,23,26-27H,10,13-14,16,18-19H2,1-6H3/b22-15+,25-17+/t21-,23-,26+,27-,29+/m1/s1 |
| InChIKey | QMNCPWIZZJOKRD-GORBQLPVSA-N |
| XLogP | 6.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|