C12H23ClN2O2 — CID 111463943
N-[(2-hydroxycyclopentyl)methyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 111463943) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is N-[(2-hydroxycyclopentyl)methyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[(2-hydroxycyclopentyl)methyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 111463943 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-[(2-hydroxycyclopentyl)methyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCC1O)C1CCCCN1 |
| InChI | InChI=1S/C12H22N2O2.ClH/c15-11-6-3-4-9(11)8-14-12(16)10-5-1-2-7-13-10;/h9-11,13,15H,1-8H2,(H,14,16);1H |
| InChIKey | QVEWZWZNTOZUIS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |