C10H14ClF3N4O2 — CID 111464677
2-[(2-amino-6-chloropyrimidin-4-yl)-[2-(2,2,2-trifluoroethoxy)ethyl]amino]ethanol (PubChem CID 111464677) has the molecular formula C10H14ClF3N4O2 and a molecular weight of 314.70 g/mol. Its IUPAC name is 2-[(2-amino-6-chloropyrimidin-4-yl)-[2-(2,2,2-trifluoroethoxy)ethyl]amino]ethanol.
| Compound Name | 2-[(2-amino-6-chloropyrimidin-4-yl)-[2-(2,2,2-trifluoroethoxy)ethyl]amino]ethanol |
|---|---|
| PubChem CID | 111464677 |
| Molecular Formula | C10H14ClF3N4O2 |
| Molecular Weight | 314.70 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[(2-amino-6-chloropyrimidin-4-yl)-[2-(2,2,2-trifluoroethoxy)ethyl]amino]ethanol |
| SMILES | Nc1nc(Cl)cc(N(CCO)CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H14ClF3N4O2/c11-7-5-8(17-9(15)16-7)18(1-3-19)2-4-20-6-10(12,13)14/h5,19H,1-4,6H2,(H2,15,16,17) |
| InChIKey | LIZMJWWELWKBIH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.70 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|