C17H27N3O — CID 111465531
4-methyl-N'-[2-(4-methylphenoxy)propyl]piperidine-1-carboximidamide (PubChem CID 111465531) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-methyl-N'-[2-(4-methylphenoxy)propyl]piperidine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[2-(4-methylphenoxy)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111465531 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-methyl-N'-[2-(4-methylphenoxy)propyl]piperidine-1-carboximidamide |
| SMILES | Cc1ccc(OC(C)C/N=C(\N)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C17H27N3O/c1-13-4-6-16(7-5-13)21-15(3)12-19-17(18)20-10-8-14(2)9-11-20/h4-7,14-15H,8-12H2,1-3H3,(H2,18,19) |
| InChIKey | JWGIDGJYPGQAIC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|