About 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine
2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine (PubChem CID 111465766) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine.
Molecular Properties
| Compound Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine |
| PubChem CID | 111465766 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine |
| SMILES | CCc1cnc(C/N=C(\N)NCCOC)s1 |
| InChI | InChI=1S/C10H18N4OS/c1-3-8-6-13-9(16-8)7-14-10(11)12-4-5-15-2/h6H,3-5,7H2,1-2H3,(H3,11,12,14) |
| InChIKey | NXAJCTXCHDZKIK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine?
The IUPAC name of 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine (CID 111465766) is 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine.
What is the SMILES notation for 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine?
The canonical SMILES for 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine is CCc1cnc(C/N=C(\N)NCCOC)s1.
What is the InChIKey of 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine?
The InChIKey is NXAJCTXCHDZKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-3-8-6-13-9(16-8)7-14-10(11)12-4-5-15-2/h6H,3-5,7H2,1-2H3,(H3,11,12,14).
What are the key properties of 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine?
2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine has a molecular weight of 242.35 g/mol, XLogP of 0.76, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-(2-methoxyethyl)guanidine is sourced from PubChem (CID 111465766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).