C18H27N5O — CID 111466454
1-[3-[[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]methylamino]propyl]piperidin-4-ol (PubChem CID 111466454) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-[3-[[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 111466454 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-[3-[[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]methylamino]propyl]piperidin-4-ol |
| SMILES | Cc1cc(CNCCCN2CCC(O)CC2)ccc1-n1cncn1 |
| InChI | InChI=1S/C18H27N5O/c1-15-11-16(3-4-18(15)23-14-20-13-21-23)12-19-7-2-8-22-9-5-17(24)6-10-22/h3-4,11,13-14,17,19,24H,2,5-10,12H2,1H3 |
| InChIKey | QGSGWQLRRVLLCW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|