About bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+)
bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) (PubChem CID 11146646) has the molecular formula C20H54Si6Yb
and a molecular weight of 636.21 g/mol. Its IUPAC name is bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+).
Molecular Properties
| Compound Name | bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) |
| PubChem CID | 11146646 |
| Molecular Formula | C20H54Si6Yb |
| Molecular Weight | 636.21 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) |
| SMILES | C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.[Yb+2] |
| InChI | InChI=1S/2C10H27Si3.Yb/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;/h2*1-9H3;/q2*-1;+2 |
| InChIKey | LSECPAWXZWQYIH-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.21 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+)?
The IUPAC name of bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) (CID 11146646) is bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+).
What is the SMILES notation for bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+)?
The canonical SMILES for bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) is C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.C[Si](C)(C)[C-]([Si](C)(C)C)[Si](C)(C)C.[Yb+2].
What is the InChIKey of bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+)?
The InChIKey is LSECPAWXZWQYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H27Si3.Yb/c2*1-11(2,3)10(12(4,5)6)13(7,8)9;/h2*1-9H3;/q2*-1;+2.
What are the key properties of bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+)?
bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) has a molecular weight of 636.21 g/mol, XLogP of 8.39, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(trimethylsilyl)methyl-trimethylsilane);ytterbium(2+) is sourced from PubChem (CID 11146646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).