C20H32N2O — CID 111466478
[1-[4-[[(3-ethylcyclopentyl)amino]methyl]phenyl]piperidin-4-yl]methanol (PubChem CID 111466478) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is [1-[4-[[(3-ethylcyclopentyl)amino]methyl]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[[(3-ethylcyclopentyl)amino]methyl]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 111466478 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | [1-[4-[[(3-ethylcyclopentyl)amino]methyl]phenyl]piperidin-4-yl]methanol |
| SMILES | CCC1CCC(NCc2ccc(N3CCC(CO)CC3)cc2)C1 |
| InChI | InChI=1S/C20H32N2O/c1-2-16-3-6-19(13-16)21-14-17-4-7-20(8-5-17)22-11-9-18(15-23)10-12-22/h4-5,7-8,16,18-19,21,23H,2-3,6,9-15H2,1H3 |
| InChIKey | VKKYCJAHKKVLMI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|