C24HBF19- — CID 11146777
tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluorophenyl)boranuide (PubChem CID 11146777) has the molecular formula C24HBF19- and a molecular weight of 661.05 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluorophenyl)boranuide.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluorophenyl)boranuide |
|---|---|
| PubChem CID | 11146777 |
| Molecular Formula | C24HBF19- |
| Molecular Weight | 661.05 g/mol |
| Exact Mass | 660.99 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(2,3,5,6-tetrafluorophenyl)boranuide |
| SMILES | Fc1cc(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C24HBF19/c26-2-1-3(27)9(29)4(8(2)28)25(5-10(30)16(36)22(42)17(37)11(5)31,6-12(32)18(38)23(43)19(39)13(6)33)7-14(34)20(40)24(44)21(41)15(7)35/h1H/q-1 |
| InChIKey | JPVANOLHXCSWOF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.05 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|