C16H27NO3 — CID 111467860
4-ethoxy-2-[[(4-hydroxy-2,2-dimethylpentyl)amino]methyl]phenol (PubChem CID 111467860) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-ethoxy-2-[[(4-hydroxy-2,2-dimethylpentyl)amino]methyl]phenol.
| Compound Name | 4-ethoxy-2-[[(4-hydroxy-2,2-dimethylpentyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 111467860 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-ethoxy-2-[[(4-hydroxy-2,2-dimethylpentyl)amino]methyl]phenol |
| SMILES | CCOc1ccc(O)c(CNCC(C)(C)CC(C)O)c1 |
| InChI | InChI=1S/C16H27NO3/c1-5-20-14-6-7-15(19)13(8-14)10-17-11-16(3,4)9-12(2)18/h6-8,12,17-19H,5,9-11H2,1-4H3 |
| InChIKey | QLJRMYPVULMQLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|