About 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol
5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol (PubChem CID 111467957) has the molecular formula C15H28ClN3O
and a molecular weight of 301.86 g/mol. Its IUPAC name is 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol |
| PubChem CID | 111467957 |
| Molecular Formula | C15H28ClN3O |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(O)CC(C)(C)CNCc1c(C(C)C)nn(C)c1Cl |
| InChI | InChI=1S/C15H28ClN3O/c1-10(2)13-12(14(16)19(6)18-13)8-17-9-15(4,5)7-11(3)20/h10-11,17,20H,7-9H2,1-6H3 |
| InChIKey | UYIWMZMYOYGPCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol?
The IUPAC name of 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol (CID 111467957) is 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol?
The canonical SMILES for 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol is CC(O)CC(C)(C)CNCc1c(C(C)C)nn(C)c1Cl.
What is the InChIKey of 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol?
The InChIKey is UYIWMZMYOYGPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28ClN3O/c1-10(2)13-12(14(16)19(6)18-13)8-17-9-15(4,5)7-11(3)20/h10-11,17,20H,7-9H2,1-6H3.
What are the key properties of 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol?
5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol has a molecular weight of 301.86 g/mol, XLogP of 3.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 111467957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).