C17H27ClN4O — CID 111468024
5-[(6-chloro-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)methylamino]-4,4-dimethylpentan-2-ol (PubChem CID 111468024) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 5-[(6-chloro-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)methylamino]-4,4-dimethylpentan-2-ol.
| Compound Name | 5-[(6-chloro-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)methylamino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 111468024 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 5-[(6-chloro-1-propan-2-ylpyrazolo[3,4-b]pyridin-5-yl)methylamino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(O)CC(C)(C)CNCc1cc2cnn(C(C)C)c2nc1Cl |
| InChI | InChI=1S/C17H27ClN4O/c1-11(2)22-16-14(9-20-22)6-13(15(18)21-16)8-19-10-17(4,5)7-12(3)23/h6,9,11-12,19,23H,7-8,10H2,1-5H3 |
| InChIKey | GAGZLFDXFAJFAI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|