C16H26N4O — CID 111468138
4-methyl-1-[(1-propan-2-ylpyrazolo[5,4-b]pyridin-5-yl)methylamino]pentan-3-ol (PubChem CID 111468138) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-methyl-1-[(1-propan-2-ylpyrazolo[5,4-b]pyridin-5-yl)methylamino]pentan-3-ol.
| Compound Name | 4-methyl-1-[(1-propan-2-ylpyrazolo[5,4-b]pyridin-5-yl)methylamino]pentan-3-ol |
|---|---|
| PubChem CID | 111468138 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 4-methyl-1-[(1-propan-2-ylpyrazolo[5,4-b]pyridin-5-yl)methylamino]pentan-3-ol |
| SMILES | CC(C)C(O)CCNCc1cnc2c(cnn2C(C)C)c1 |
| InChI | InChI=1S/C16H26N4O/c1-11(2)15(21)5-6-17-8-13-7-14-10-19-20(12(3)4)16(14)18-9-13/h7,9-12,15,17,21H,5-6,8H2,1-4H3 |
| InChIKey | MYMFOTDTANVUQJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|