C43H56O6S — CID 11146893
[(10Z,14E)-2,6,14-trimethyl-7-(4-methylphenyl)sulfonyl-16-phenylmethoxy-10-(phenylmethoxymethyl)hexadeca-2,10,14-trien-6-yl] acetate (PubChem CID 11146893) has the molecular formula C43H56O6S and a molecular weight of 700.98 g/mol. Its IUPAC name is [(10Z,14E)-2,6,14-trimethyl-7-(4-methylphenyl)sulfonyl-16-phenylmethoxy-10-(phenylmethoxymethyl)hexadeca-2,10,14-trien-6-yl] acetate.
| Compound Name | [(10Z,14E)-2,6,14-trimethyl-7-(4-methylphenyl)sulfonyl-16-phenylmethoxy-10-(phenylmethoxymethyl)hexadeca-2,10,14-trien-6-yl] acetate |
|---|---|
| PubChem CID | 11146893 |
| Molecular Formula | C43H56O6S |
| Molecular Weight | 700.98 g/mol |
| Exact Mass | 700.38 |
| IUPAC Name | [(10Z,14E)-2,6,14-trimethyl-7-(4-methylphenyl)sulfonyl-16-phenylmethoxy-10-(phenylmethoxymethyl)hexadeca-2,10,14-trien-6-yl] acetate |
| SMILES | CC(=O)OC(C)(CCC=C(C)C)C(CC/C(=C/CC/C(C)=C/COCc1ccccc1)COCc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C43H56O6S/c1-34(2)15-14-29-43(6,49-37(5)44)42(50(45,46)41-25-22-36(4)23-26-41)27-24-40(33-48-32-39-19-11-8-12-20-39)21-13-16-35(3)28-30-47-31-38-17-9-7-10-18-38/h7-12,15,17-23,25-26,28,42H,13-14,16,24,27,29-33H2,1-6H3/b35-28+,40-21- |
| InChIKey | WSYDCEXUSXDWRP-ZPLKTSGWSA-N |
| XLogP | 10.07 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.98 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|