C22H17Cl7N2O10 — CID 11146961
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11146961) has the molecular formula C22H17Cl7N2O10 and a molecular weight of 717.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11146961 |
| Molecular Formula | C22H17Cl7N2O10 |
| Molecular Weight | 717.55 g/mol |
| Exact Mass | 713.87 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H17Cl7N2O10/c1-5(32)37-4-8-16(38-6(2)33)17(39-7(3)34)15(20(40-8)41-21(30)22(27,28)29)31-18(35)9-10(19(31)36)12(24)14(26)13(25)11(9)23/h8,15-17,20,30H,4H2,1-3H3/b30-21+/t8-,15-,16-,17-,20+/m1/s1 |
| InChIKey | FXNYGSGIRMMFRO-ZUHFRMEISA-N |
| XLogP | 4.78 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|