C19H32N2O — CID 111470651
4-[[4-(azepan-1-yl)phenyl]methylamino]-3,3-dimethylbutan-1-ol (PubChem CID 111470651) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-[[4-(azepan-1-yl)phenyl]methylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[[4-(azepan-1-yl)phenyl]methylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 111470651 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | 4-[[4-(azepan-1-yl)phenyl]methylamino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(CCO)CNCc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H32N2O/c1-19(2,11-14-22)16-20-15-17-7-9-18(10-8-17)21-12-5-3-4-6-13-21/h7-10,20,22H,3-6,11-16H2,1-2H3 |
| InChIKey | QHBYIUNKVABWSA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|