C18H16N2O4S — CID 1114731
(2,6-dimethylphenyl) 2-[[5-(2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 1114731) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-[[5-(2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (2,6-dimethylphenyl) 2-[[5-(2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 1114731 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2,6-dimethylphenyl) 2-[[5-(2-hydroxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | Cc1cccc(C)c1OC(=O)CSc1nnc(-c2ccccc2O)o1 |
| InChI | InChI=1S/C18H16N2O4S/c1-11-6-5-7-12(2)16(11)23-15(22)10-25-18-20-19-17(24-18)13-8-3-4-9-14(13)21/h3-9,21H,10H2,1-2H3 |
| InChIKey | MFSXUZSBFVWAKZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|