C15H23N3O4 — CID 111473687
1-(4-ethyl-3-nitrophenyl)-3-(3-hydroxy-4-methylpentyl)urea (PubChem CID 111473687) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(4-ethyl-3-nitrophenyl)-3-(3-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-(4-ethyl-3-nitrophenyl)-3-(3-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 111473687 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(4-ethyl-3-nitrophenyl)-3-(3-hydroxy-4-methylpentyl)urea |
| SMILES | CCc1ccc(NC(=O)NCCC(O)C(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O4/c1-4-11-5-6-12(9-13(11)18(21)22)17-15(20)16-8-7-14(19)10(2)3/h5-6,9-10,14,19H,4,7-8H2,1-3H3,(H2,16,17,20) |
| InChIKey | QAJATXRQABIUPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|