C10H13F3N2O3 — CID 111474174
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 111474174) has the molecular formula C10H13F3N2O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 111474174 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(O)(CNC(=O)NCC(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C10H13F3N2O3/c1-9(17,7-3-2-4-18-7)5-14-8(16)15-6-10(11,12)13/h2-4,17H,5-6H2,1H3,(H2,14,15,16) |
| InChIKey | KLBDRXWEBJFBMS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |