About 4-bromo-2,6-diphenylphenol
4-bromo-2,6-diphenylphenol (PubChem CID 11147454) has the molecular formula C18H13BrO
and a molecular weight of 325.21 g/mol. Its IUPAC name is 4-bromo-2,6-diphenylphenol.
Molecular Properties
| Compound Name | 4-bromo-2,6-diphenylphenol |
| PubChem CID | 11147454 |
| Molecular Formula | C18H13BrO |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 4-bromo-2,6-diphenylphenol |
| SMILES | Oc1c(-c2ccccc2)cc(Br)cc1-c1ccccc1 |
| InChI | InChI=1S/C18H13BrO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h1-12,20H |
| InChIKey | IFIDCVMUVQKUIS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2,6-diphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-diphenylphenol?
The IUPAC name of 4-bromo-2,6-diphenylphenol (CID 11147454) is 4-bromo-2,6-diphenylphenol.
What is the SMILES notation for 4-bromo-2,6-diphenylphenol?
The canonical SMILES for 4-bromo-2,6-diphenylphenol is Oc1c(-c2ccccc2)cc(Br)cc1-c1ccccc1.
What is the InChIKey of 4-bromo-2,6-diphenylphenol?
The InChIKey is IFIDCVMUVQKUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO/c19-15-11-16(13-7-3-1-4-8-13)18(20)17(12-15)14-9-5-2-6-10-14/h1-12,20H.
What are the key properties of 4-bromo-2,6-diphenylphenol?
4-bromo-2,6-diphenylphenol has a molecular weight of 325.21 g/mol, XLogP of 5.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-diphenylphenol is sourced from PubChem (CID 11147454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).