C20H20N6S2 — CID 1114756
6-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 1114756) has the molecular formula C20H20N6S2 and a molecular weight of 408.56 g/mol. Its IUPAC name is 6-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1114756 |
| Molecular Formula | C20H20N6S2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 6-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(Nc3ccc(C)cc3)nc(SC3=NCCS3)n2)cc1 |
| InChI | InChI=1S/C20H20N6S2/c1-13-3-7-15(8-4-13)22-17-24-18(23-16-9-5-14(2)6-10-16)26-19(25-17)28-20-21-11-12-27-20/h3-10H,11-12H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | ZJWBZFOKZAAIAQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |